Provide the mechanism for the production of phenanthrene from compound A. please see attached. Hello Dr. Robinson, For this problem, there are multiple steps the mechanism can start with. The way I think this problem is approached by first is having the hydrogen attack the sodium hydroxide to form water, and having the h
Which of the following will give 2-methyl-1-butene as the only alkene on treatment with KOC(CH3) in dimethyl sulfoxide? a) 2-methylbutane b) 1-bromo-2-methylbutane c) 2-bromo-2-methylbutane d) 2-methyl-1-butanol e) 2-methyl-2-butanol
(a) How many resonance structures are there for the cyclohepatrienyl cation? Draw them. (b) Are carbon-carbon bonds equivalent? (c) How many peaks would you expect to see in the 1H NMR as well as the 13C NMR spectra of this cation? (d) Use the Frost Circle to draw the energy levels of the Pi molecular orbitals for this
Thanks for all your help on a side note! Rhamnose questions: 1. Draw both chair conformations of the alpha-anomer of rhamnose in its pyranose form. Circle the more stable conformation. 2. Provide the complete structure for the alpha-anomer in its pyranose form. 3. Name Sorboses Systematically. * I don't understand
I always get confused on these: can H2 exhibit hydrogen bonding I know CH3OH does exhibit hydrogen bonding the other one I'm not sure about is: C2H2 can this have hydrogen bonding?
Which of these have the most surface tension CO2 CH4 NH3 thanks!
Structure Drawing 1. Draw: trans-3-isopropylcyclohexanecarbaldehyde 2. IUPAC 3. The exact position of the equilibrium between ketones/aldehydes and their hydrates depends on the structure of the carbonyl compound. Although the equilibrium favors the carbonyl compound in most cases, cyclopranone forms a stable hydrate. E
I have a structure (see attachment) that I can't manage to properly draw the resonance structure for. If I could have an explanation resonance and how to go about doing this problem (or one similar), it would be greatly appreciated!
Explain the characteristics of a single, double, and triple bonds including why they form and how the electrons arrange themselves.
Draw the structure of each of the following compounds: A) 3-nitropyridine b) 5-bromo-2-nitroaniline c) 2-propenyl-4-methoxyphenol d) N-ethyl-N,N-dimethyl-N-phenylammonium acetate e) 3,4,5-trihydroxybenzoic acid (or gallic acid)
Please see attached. A cellulose polymer is shown (2 glucose monomers joined by a glycosidic bond) ----- as drawn by our professor, the oxygen in the monomer/polymer appears to have 2 unpaired electrons ---- is this true and does that make the monomer/polymer anionic??? Most importantly....we are asked to determine how met
Calculate the heat of combustion of cyclohexatriene using the bond energies for C=C,C-C, and CH provided below. The actual value measured experimentally is 3331.2 KJ/mol. What is the percentage difference between the measured and calculated value? Bond Energy [kj (kcal)}: C=C 611 (146) C-C 350 (83) CH 420 (100).
Suppose that you are carrying out a dehydrohalogenation reaction on 2-bromo-2,3-dimethylpentane to yield alkenes. Once the reaction is complete and the two elimination products have been isolated into separate vials, how could you use IR spectroscopy to identify which alkene is in which vial? How do you determine what the wav
Unknown compound A (C8H12) is reacted with H2 (excess) in the presence of a palladium catalyst forming compound B (C8H16). In addition when compound A is reacted with O3 followed by zinc and acetic acid the following two compounds are formed: CH3-C(=O)-CH2-CH2-C(=O)-CH3 and HC(=O)-(O=)CH Using the following data determine
1. What is the AE___________ NE___________ Lewis Structure VSEPR Sketch VB Sketch description for Ammonia, NH3, Ammonium ion, NH4+. Carbon monoxide, CO, Carbon dioxide, CO2, Phosgene, COCl2, hexafluorosilicate(IV) ion, SiF62, Nitrogen dioxide, NO2, and Sulfur tetrafluoride, SF4? 2. Draw the Lewis structure representin
Identify the two important classes of catalysts. Analyze the chemical reactions that take place when a biological catalyst combines with a reactant (substrate) to form an unstable intermediate.
In an experiment you combine 4-methyl-2-pentene and water, in the lab you setup the experiment using a a heater, condenser and N2 gas and add the reagent H2SO4, the product formed is 2-methyl-2-pentanol. Which molecular species would be necessary for the formation of the product in the reaction; a primary carbocation, a tertiar
I need some assistance with a 5 part organic chemistry question involving the skeletal form of Caffeine and the bonds formed in the structure. Please include complete detail for each part. I have part of the problem completed and am looking for confirmation. a. Draw the structure of Caffeine. Skeletal form only. b.
Chapter 11 Homework: VSEPR and Valence Bonding 1.Select all the polar molecules. a. BrF5 b. BF3 c. PF6− d. IF4− e. NH4+ f. CH2F2 Select all the polar molecules. a. I3− b. IF3 c. TeF42− d. SeF4 e. ClO3− f. ClO4−
I am trying to put together a very basic chemical diagram that shows how the hydrolysis of a cellulose polymer actually occurs. In other words, if we started with the cellulose polymer and then water and heat, what are the hydrolysis by-products? What limits the reaction? What determines whether the hydrolysis reaction proceeds
Please see the attached file for the fully formatted problems. Question 1: In the reaction of 4-Nitrobenzaldehyde + Acetophenone -> trans-4-Nitrochalcone a. The yield of the reaction to form your chalcone is not quantitative. What side products might be formed from your aldol condensation? b. If one uses benza
In the first step of the catalytic cycle, the alkene bonds to palladium to make a new metal complex The alkene is now a ligand because the pi-bond of the alkene is donating some of its electrons to palladium If the alkene is an electron donor, would you expect the alkene in the complex to have a positive charge or a negative c
Please help with the following chemical bonding problems, and provide step by step calculations. The iodine monobromide molecule, IBr, has a bond length of 2.49 Angstroms and a dipole moment of 1.21 D. a) Which atom of the molecule is expected to have a negative charge? b) Calculate the effective charges on the I and Br atom
Carbon and silicon belong to the same group and are known to have similar properties. Do you think that silicon can replace the role that carbon plays in organic chemistry?
What does the 1H-NMR spectrum and the IR spectrum look like (with notations on each peak on both spectra) for propyl p-tolyl ether?
Question 1 Kn1 knowledge and understanding of atomic and molecular structure, chemical bonding, chemical formulas, chemical equations, mole calculations and the mole concept and the relation between elements of the Periodic Table. Ky1 use mathematical skills appropriate to the study of science at this level, in particular: n
See the attached files. 1. Show a set of pathways (some good, some bad) for making the target from benzene in three steps. See file attachment. 2. Show a reasonable synthesis for the compound in fig 2 starting from benzene or toluene. See file attachment 3. Consider a synthesis of the following alcohol starting from bro
Please see the attached file for the fully formatted problem(s). Activity - Solution Calculations 1. What is the Zn(NO3)2 percent composition by weight of a solution made by dissolving 15.5 g of zinc nitrate, Zn(NO3) 2, in 45.0 g of water? (%) Use three significant figues in your answer. 2. How many moles of sodium hyd
Suggest an explanation for the fact that the order of reactivity of the halides toward n-butylbrosylate in acetone is Clֿ > Brֿ > Iֿ when (C4H9)4N+ is the cation of the halide salt, but Iֿ > Brֿ > Clֿ when Li+ is the cation.
1. Why is sulfuric acid, rather than hydrochloric acid, used to catalyze the dehydration of alcohols? 2. A sample of 150 mg of an organic compound is dissolved in 7.5 ml of water. The solution is paced in a 20-cm polarimeter tube and the rotation measured in a polarimeter. The rotation observed was +2.676 degrees. Distil