1. In the bromination of n-butane, the secondary hydrogens are 20 times more reactive than the primary hydrogens. What is the product ratio of 1-bromobutane to 2-bromobutane? a. 6:4 b. 1:20 c.93:7 d. 7:93 2. Rank the free radicals (I-III) shown below in order of decreasing stability (ie, most stable to least s
1. An energy maximum in a reaction-energy diagram would be labeled as which of the following? a. Reactant b. Product c. Transition State d. Intermediate 2. Which of the following best describes the shape of the methyl free radical? a. linear b, planar c, tetrahedral d. pyramidal
1. Which of the following correctly lists the following isomeric alkanes in order of increasing boiling point? n-hexane, 2,3-dimethylbutane, 2-methylpentane a. n-hexane < 2-methylpentane < 2,3- dimethylbutane b. 2-methylpentane < 2,3-dimethylbutane < n-hexane c. 2,3-dimethylbutane < 2-methylpentane < n-hexane d. n-hexa
Can you please explain the molecular bonding of hydrocortisone. How many functional groups and what are they? I need the explanation of the actual chemical structure and the chemistry behind the structure.
1. Draw the structure of bicyclo [3.2.0] heptane. 2. Consider the following compounds: CH3-CH2-CH2-CH2-CH3 CH3-CH2-CH2-NH-CH3 CH3-CH2CH2-CH2OH Predict their relative boiling points (rank from low (1) to (3)). Explain answer in terms of the intermolecular forces involved. 3. Draw a three-dimensional structure of CH3C
1. The C-O-C bond angle (degees) in the compound CH3-O-CH3 is closest to a. 90 b. 109 c. 120 d. 180 2. Which of the following molecules would be expected to be MOST water soluble? a. CH3-CH2-CH2-CH2-CH3 b. CH3-CH2-O-CH2-CH3 c. HOCH2-CH2-CH2OH d. ClCH2-CH2-CH2Cl 3. The relationship between CH3CH2OH and HOCH2C
1. The number of different constitutional isomers that can be drawn for C2H4Br2 is equal to a.1 b. 2 c.3 d. 4 2. The order of boiling points of the simple alkanes CH4, C2H6, and C3H8 is a. CH4 < C2H6< C3H8 b. CH4 > C2H6> C3H8 c. C2H6 < CH4 < C3H8 d. CH4 < C2H6 > C3H8 3.Which of the following statements about
(See attached file for full problem description) 1. Draw Newman Projections constructed by looking down the indicated carbon-carbon bond in the following molecule and make a graph of energy versus dihedral angle. 2. Predict the most stable conformation of hexane. Draw a line wedge formula for this confirmation (hint: consi
Which of the following structures contain atoms with a formal charge? Indicate the atom and the charge. Do any of the structures have a net (non-zero) charge? See attached for structures Describe the type of bonding that occurs in H-CH2-OH
I have a problem with reactions. CH3-CH2-C-CH3 + (O) THERE IS AN -OH AND A METHYL ATTACHED TO THE SINGLED OUT -C And also the same problem, but reacting with H+
1. A sample of unknown Y is subjected to elemental analysis. The following percentages by weight are found to be: C 40.0% H 6.7% O remainder of % by weight The molar mass is found to be 60.0 g A. Calculate the empirical formula (show work) B. What is the molecular formula of unknown Y. (Include r
A.) Write a complete mechanism for the addition of diethyl malonate to ethanal in the presence of base to form a beta-hydroxy ester. B.) Outline a sythensis that forms at least on C - C bond for each of the following compounds: 1.) CH3CH2CH2CH2CH2CH=CHCO2H 2.) CH3CH2CH2CH=C(CN)(CO2CH2CH3)
Use IR tables to locate absorption bands of the stretching frequencies of the alkyne C - H bond, the alkyne C - (triple bond)- C , and the alkene C - H bond. Using this data, explain how you would distinguish between 1-butyne, 2-butyne, and 2-butene.
Compounds containing carbon-carbon triple bond undergo the Diels-Alder reaction. Formulate the product formed by the reaction of (E,E)-1,4-dipjhenyl-1-3-butadiene with diethyl acetylenedicarboxylate. Show reaction.
Organic chemistry structural problem with for Methyl Ketone: In organic chemistry, there is a ketone structure that has the carbon bonded twice with the oxygen(C=O)with two components on the side...the question is how or where do I attach the methyl(CH3) on to this Ketone structure? (See attachment for diagram)
1.) Chlorotrimethylsilane reacts with enolate anions to form stable ethers. For example (see reaction attached) Assuming that the reaction is run under equilibrium conditions predict which of the silyl enol ethers below is formed in the largest amount and why? 2.) There are two reasons why the enols of beta-dicarbonyl compoun
Indicate the reaction conditions you would employ to accomplish the following: a. Conversion of tert-butyl chloride to 2-methylpropene to maximize the yield of the elimination product over the substitution product. b. The conversion of tert-butylchloride to tert-butyl ethyl ether to insure the highest possible yield of the eth
For each of the (attached) compounds, identify them as 1) the same or 2) constitutional isomers or 3) geometric isomers or 4) enantiomers or 5) different compounds that are not isomers.
Please see attached structures and name them (I'm new to drawing in Word. Get ready for a good laugh.) Name each of the following O (That's supposed to be a dbl bond over C2 to O) C-C-N-C-C H C-C-C N C-C-C-N-C-C-C C-C-C O (should be a double bo
Please see attached for diagram ... Questions: Will this disaccharide give a positive Benedict's test? Why or why not? Does this structure have a hemiacetal, hemiketal, acetal, or ketal system? Locate it on the drawing & give appropriate label. Upon hydrolysis with the appropriate enzyme, what will be the products?
Complete the reactions. 1. What does stearic acid and sodium hydroxide yield? 2. C-C-N-H +HCl H 3. H2 CH3CH2(CH=CHCH2)5COOH Pt 4. O = C-O-C-(CH2)12CH3 - 5. O =
Hi. We were given a practice sheet with review questions. Can you briefly tell me why on each so I can apply it on test? Thanks. Higher solubility - Butanedioic acid or Butanal Higher mp - 2,3-dihydroxy propanal or Pentanal Lower mp - Sodium octanoate or Octanoic acid Lower solubility - 2-hexanone or 2-hexanol
Why is sugar stable under standard conditions. In contrast to the high stability of sugar in daily use it burns rapidly when ignited without any 'booster' like sulphur or alkali nitrates.
What determines whether a group on a benzene ring will be activating or deactivating and ortho para or meta directing?
How can you know that HNO3 is nitric acid and HNO2 is nitrous acid? How do you know the difference in endings? Is there a formula for this to tell the difference? They are so closely related. I see this is common when naming acids. How can you tell as well, that HCLO is chloric acid. I would think it was hydrochloric acid.
I am having some trouble explaining why the attached molecule is an otho-para director although a weak deactivator. I believe it is because of resonance forms, but that is as far as I have gotten. See the attached file.
What is the hybridization of an AXmEn molecule? How can I find the AXmEn formula?
Question: Provide a retrosynthetic and forward analysis for the following molecule, starting from commercially available compounds.The retrosynthesis should clearly identify the synthons and their synthetic equivalents. Also functional group inter-conversions and bond disconnections should be clearly indicated where needed.The f
Provide a retrosynthetic and forward analysis for the following molecule, starting from commercially available compounds. The retrosynthesis should clearly identify the synthons and their synthetic equivalents. Also functional group interconversions and bond disconnections should be clearly indicated where needed. The forward
Please help with Fiedel-Crafts reactions and the end results of the product. Please explain the attached question - predicting the major products of each reaction and naming the product. Also, if no reaction occurs, please provide a reasonable explanation as to why that is the case.