Share
Explore BrainMass

Organic Chemistry

AP Chemistry - cyclohexane

2. Consider the molecule cyclohexane, which contains only hydrogen and carbon atoms. a) When a sample is burned in oxygen, 4.822 g of CO(2) and 1.650g of H(2)O are obtained. What is its simplest formula? b) Calculate the mass percent of carbon and hydrogen in cyclohexene. c) How many grams of carbon would you obtain fro

Compounds of Reactions

Explain why compound A reacts 9000 times faster than compound B at 0 degrees, but the two compounds react at the same rate at 103 degrees.

Which of the following molecules has NO net molecular dipole?

1. Which of the following molecules has NO net molecular dipole? a. CH3OH b. CH2O c. CH3Cl d. H2C=CH2 2. Which of the following molecules can hydrogen bond to another of the same compound? a. CH3CH2OCH2CH3 b. CH3CH2COOCH3 c. (CH3CH2)2CHOH d. CH3CH2COCH2CH3 3. What term best describes the relationship betwe

2 alkyl group

Define what we mean by an alkyl group? Please answer in full. Thanks for your time.

Properties of alkanes

If gasoline is spilled into a lake, an oil slick floating on the surface forms rapidly. What properties of alkanes are responsible for such oil slicks?

Flowsheet

Write a flow sheet to show the logical process in use of silver nitrate and sodium iodide reagent tests to determine whether an unknown alkyl is primary, secondary, or tertiary.

Molar solubility

Molar Solubility. Calculate the molar solubility of the following compounds from the Ksp values given. a) ksp=2.1 x 10-16 b) ksp= 2.5 x 10-39 a. Zn(OH)2 b. Fe(OH)3

Equation for complete combustion e.g. ethane and cyclopropane

My chemistry book asks the question: Write the balanced equation for the complete combustion of each of the following compounds: a. ethane, C2 H6 The book has the answer which reads: 2C2h6 + 7O2 I don't understand where the formula for 7 02 b. cyclopropane I understand the formula C3H10 but I do

Reactiveness

Expain why dinotrogen, N2, is a very stable molecule, but ethyne, C2H2, is very reactive. Note that both molecules have triple bonds.

Drawing Organic Substances

I need help in learning how to draw organic substances. For example- Diethyl ether. As well, what is meant by drawing the isomer of the structural formula?

Organic Chemistry: Alcohols

Hi, I need some assistance with this organic chemistry concept. Could you show me how to draw all the alcohols that have the molecular formula C5H11OH. I also need assistance assigning the names to each compound and explaining if they are primary, secondary, or tertiary alcohols.

Isomers or enantiomers

CH2OH CHO l l --l--OH --l--OH --l--OH --l--OH l l CHO CH2OH Are these compounds the same, c

Reactivity of aldehydes

How would I list the following aldehydes in terms of increasing reactivity ClCH2CHO, CH3CHO, Cl3CCHO, and Cl2CHCHO? How would I explain the reasoning behind the answer in simple terms?

Ionic Activities

Find the activity(not the activity coefficient) of the (C3H7)4N+ (tetrapropylammonium) ion in a solution containing 0.005 M (C3H7)4N+Br- plus 0.005 M (CH3)4N+Cl-. Activity coefficients : Ionic strength .001 .005 .01 .05 0.1 (C3H7)4N+ : .966 .931 .912 .85 .82 CH3)4N+:

Oleic Acid

The chemical formula for oleic acid is CH3(CH2)7CH:CH(CH2)7COOH. What would be a balanced equation for the complete oxidation of one mole of oleic acid?

Information About Sulfur

Question: How many isotopes does sulfur have and what are the natural abundances of the four most abundant isotopes?

Drawing Meso Forms

Which of the following compounds have a meso form? (a) 2,3-Dibromopentane (b) 2,4-Dibromopentane (c) 2,3-Dibromobutane

Pressure in atm

What is the pressure in atm of 1.00g of NH3(g) in a 500mL container at 20 C? See attached file for full problem description.

Conversions

1.) is 47.8 ng/L = 0.0478ppb? and if so would that above concentration be above 10,000 ug/L (what would this be in ppb) 2.) is 6.77 ng/m^3 = 0.0066 ppb? an if so, would that exceed 0.5-5g/Kg for a 70 kg person (which is a lethal concentration) (and what would this be in ppb) and would that exceed Lethal co

Stability and (R or S) Configuration

(a) Which conformer, K or L is predicted to be more stable? Explain your answer (Note: a methoxy group is smaller than a methyl group). (b) Assign the absolute (R or S) configurations for each of the chiral carbons in carbohydrates M and N. Are either of these compounds optically active? Briefly explain your answer.