oxidation-reduction

I am having trouble with this question: I want to know if I have the correct answer (my answer is at the bottom. Observations: i) A reacts spontaneously with 1 mol/L BNO3, 1 mol/L D(NO3)2 and dilute sulfuric acid. A does not react with 1 mol/L C(NO3)2 ii) B does not react spontaneously with any of the 1 mol/L soluti ...continues

The definition which is used in everday chemistry. Quite useful in understanding chemistry and mostly wrongly understood.

IUPAC WHAT DOES IT MEAN .

EXPLAIN AN OBSERVATION

When glass is heated, a yellow flame is observed around the point of heating. What does the yellow flame indicate? Why is it observed when glass is heated? I think it indicates the spectrum of the silicon in glass & occurs when the glass is heated because the heat energy excites the electrons in the glass.

OLEIC ACID

The chemical formmula for oleic acid is CH3(CH2)7CH:CH(CH2)7COOH. What would be a balanced equation for the complete oxidation of one mole of oleic acid?

Restaurant- Boling Stones

I have a question that I found in a text book, can anyone help me answer it. It seems to be safe. Some of you are concerned with the fact that the operator of a vietemese restaurant used some stones as "boiling chips" in the pots where they cook food. Please provide a paragraph to provide rationale to support your (or n ...continues

gases mixtures and movements

the following reaction takes place in a sealed 40.0-L container at a temp of 120 degrees C 4NH 3(G) + 5 O2 (g) --> 4NO (g) + 6H2O (G) a) when 34.0g of NH3 reacts with 96.0g of O2 what is the partial pressure of NO in the sealed container? b) what is the total pressure in the container

Chemistry Equation

I am requesting assistance for the following equations: Propane (C3H8) burns in oxygen to produce carbon dioxide gas and water vapor. Calculate the number of liters of carbon dioxide measured at STP that could be produced from 7.45 g of propane. A sample of nitrogen gas kept in a container of volume 2.3L and at a temper ...continues

Calculation

Please check this problem and provide explanation. Calculate the pH of each of the following solutions: (a) 0.0010 M HCL (b) 0.76 M KOH 15.19) Calculate the Hydrogen ion concentration in mol/L for solutions with the following pH values: (a) 2.42 pH=-log[H+] 2.42=-log[H+] [H+]=10-2.42=3.8x10-3M(mol/L) (b) 11 ...continues

Calculations

Calculate the molar solubility of AgCl in a 1.00L solution containing 10.0g of dissolved CaCl2 Compare the molar solubility of Mg(OH)2 in water and in a solution buffered at a pH of 9.0.

Calculation

Calculate the heat of decomposition for this process at constant pressure and 25o: CaCO3(s) ---> CaO(s) + CO2(g)